EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O5 |
| Net Charge | 0 |
| Average Mass | 282.336 |
| Monoisotopic Mass | 282.14672 |
| SMILES | CCCCCCCCOC(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C15H22O5/c1-2-3-4-5-6-7-8-20-15(19)11-9-12(16)14(18)13(17)10-11/h9-10,16-18H,2-8H2,1H3 |
| InChIKey | NRPKURNSADTHLJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | food antioxidant An antioxidant that used as a food additives to help guard against food deterioration. |
| Biological Roles: | food antioxidant An antioxidant that used as a food additives to help guard against food deterioration. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | food antioxidant An antioxidant that used as a food additives to help guard against food deterioration. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| octyl gallate (CHEBI:83631) has role food antioxidant (CHEBI:77962) |
| octyl gallate (CHEBI:83631) has role hypoglycemic agent (CHEBI:35526) |
| octyl gallate (CHEBI:83631) has role plant metabolite (CHEBI:76924) |
| octyl gallate (CHEBI:83631) is a gallate ester (CHEBI:37576) |
| IUPAC Name |
|---|
| octyl 3,4,5-trihydroxybenzoate |
| Synonyms | Source |
|---|---|
| Gallic acid octyl ester | HMDB |
| n-Octyl gallate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0033375 | HMDB |
| Octyl_gallate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2132305 | Reaxys |
| CAS:1034-01-1 | ChemIDplus |
| Citations |
|---|