EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17ClN2O |
| Net Charge | 0 |
| Average Mass | 324.811 |
| Monoisotopic Mass | 324.10294 |
| SMILES | O=C1CN=C(c2ccccc2)c2cc(Cl)ccc2N1CC1CC1 |
| InChI | InChI=1S/C19H17ClN2O/c20-15-8-9-17-16(10-15)19(14-4-2-1-3-5-14)21-11-18(23)22(17)12-13-6-7-13/h1-5,8-10,13H,6-7,11-12H2 |
| InChIKey | MWQCHHACWWAQLJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Applications: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Prazepam (CHEBI:8362) has role anxiolytic drug (CHEBI:35474) |
| Prazepam (CHEBI:8362) is a benzodiazepine (CHEBI:22720) |
| Synonyms | Source |
|---|---|
| NSC-277179 | ChEMBL |
| prazene | DrugCentral |
| Prazepam | KEGG COMPOUND |
| Prazepam civ | ChEMBL |
| sedapran | DrugCentral |
| trepidan | DrugCentral |
| Brand Names | Source |
|---|---|
| Centrax | ChEMBL |
| Demetrin | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2240 | DrugCentral |
| C07366 | KEGG COMPOUND |
| D00470 | KEGG DRUG |
| HMDB0015527 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:2955-38-6 | KEGG COMPOUND |
| Citations |
|---|