EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H20Cl2N2OS.HNO3 |
| Net Charge | 0 |
| Average Mass | 518.422 |
| Monoisotopic Mass | 517.06298 |
| SMILES | Clc1ccc(C(Cn2ccnc2)OCc2ccc(Sc3ccccc3)cc2)c(Cl)c1.O=[N+]([O-])O |
| InChI | InChI=1S/C24H20Cl2N2OS.HNO3/c25-19-8-11-22(23(26)14-19)24(15-28-13-12-27-17-28)29-16-18-6-9-21(10-7-18)30-20-4-2-1-3-5-20;2-1(3)4/h1-14,17,24H,15-16H2;(H,2,3,4) |
| InChIKey | FJNRUWDGCVDXLU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenticonazole nitrate (CHEBI:83606) has part (R)-fenticonazole nitrate (CHEBI:83608) |
| fenticonazole nitrate (CHEBI:83606) has part (S)-fenticonazole nitrate (CHEBI:83607) |
| fenticonazole nitrate (CHEBI:83606) has role antibacterial drug (CHEBI:36047) |
| fenticonazole nitrate (CHEBI:83606) is a conazole antifungal drug (CHEBI:87071) |
| fenticonazole nitrate (CHEBI:83606) is a imidazole antifungal drug (CHEBI:87069) |
| fenticonazole nitrate (CHEBI:83606) is a racemate (CHEBI:60911) |
| IUPAC Name |
|---|
| rac-1-[2-(2,4-dichlorophenyl)-2-{[4-(phenylsulfanyl)benzyl]oxy}ethyl]-1H-imidazole nitrate |
| Synonyms | Source |
|---|---|
| (+-)-1-(2,4-Dichloro-beta-((p-(phenylthio)benzyl)oxy)phenethyl)imidazole mononitrate | ChemIDplus |
| alpha-(2,4-Dichlorophenyl)-beta,N-imidazolylethyl-4-phenylthiobenzyl ether nitrate | ChemIDplus |
| fenticonazole mononitrate | ChEBI |
| Brand Name | Source |
|---|---|
| Lomexin | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| CN101288661 | Patent |
| CN101313904 | Patent |
| CN101474168 | Patent |
| CN101863808 | Patent |
| D02583 | KEGG DRUG |
| Fenticonazole | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6564060 | Reaxys |
| CAS:73151-29-8 | ChemIDplus |
| CAS:73151-29-8 | KEGG DRUG |
| Citations |
|---|