EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H14Cl2N2 |
| Net Charge | 0 |
| Average Mass | 329.230 |
| Monoisotopic Mass | 328.05340 |
| SMILES | Clc1cc(Cl)c2c(c1)CCc1ccccc1[C@@H]2n1ccnc1 |
| InChI | InChI=1S/C18H14Cl2N2/c19-14-9-13-6-5-12-3-1-2-4-15(12)18(17(13)16(20)10-14)22-8-7-21-11-22/h1-4,7-11,18H,5-6H2/t18-/m0/s1 |
| InChIKey | MPTJIDOGFUQSQH-SFHVURJKSA-N |
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-eberconazole (CHEBI:83588) is a 1-(2,4-dichloro-10,11-dihydrodibenzo[a,d][7]annulen-5-yl)imidazole (CHEBI:83584) |
| (S)-eberconazole (CHEBI:83588) is conjugate base of (S)-eberconazole(1+) (CHEBI:83596) |
| (S)-eberconazole (CHEBI:83588) is enantiomer of (R)-eberconazole (CHEBI:83587) |
| Incoming Relation(s) |
| eberconazole (CHEBI:82862) has part (S)-eberconazole (CHEBI:83588) |
| (S)-eberconazole(1+) (CHEBI:83596) is conjugate acid of (S)-eberconazole (CHEBI:83588) |
| (R)-eberconazole (CHEBI:83587) is enantiomer of (S)-eberconazole (CHEBI:83588) |
| IUPAC Name |
|---|
| 1-[(5S)-2,4-dichloro-10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-yl]-1H-imidazole |