EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H42N7O17P3S2 |
| Net Charge | 0 |
| Average Mass | 869.699 |
| Monoisotopic Mass | 869.12914 |
| SMILES | CSCCC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C25H42N7O17P3S2/c1-25(2,20(36)23(37)28-6-4-15(33)27-7-9-54-16(34)5-8-53-3)11-46-52(43,44)49-51(41,42)45-10-14-19(48-50(38,39)40)18(35)24(47-14)32-13-31-17-21(26)29-12-30-22(17)32/h12-14,18-20,24,35-36H,4-11H2,1-3H3,(H,27,33)(H,28,37)(H,41,42)(H,43,44)(H2,26,29,30)(H2,38,39,40)/t14-,18-,19-,20+,24-/m1/s1 |
| InChIKey | SIEFLYWJLBNLAM-CITAKDKDSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(methylthio)propanoyl-CoA (CHEBI:83579) has functional parent 3-(methylthio)propionic acid (CHEBI:1438) |
| 3-(methylthio)propanoyl-CoA (CHEBI:83579) is a acyl-CoA (CHEBI:17984) |
| 3-(methylthio)propanoyl-CoA (CHEBI:83579) is conjugate acid of 3-(methylthio)propanoyl-CoA(4−) (CHEBI:82815) |
| Incoming Relation(s) |
| 3-(methylthio)propanoyl-CoA(4−) (CHEBI:82815) is conjugate base of 3-(methylthio)propanoyl-CoA (CHEBI:83579) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-({3-[(2-{[3-(methylsulfanyl)propanoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-4-oxobutyl] dihydrogen diphosphate} |
| Synonym | Source |
|---|---|
| 3-(methylthio)propanoyl-coenzyme A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-13546 | MetaCyc |