EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15N5O6S |
| Net Charge | 0 |
| Average Mass | 381.370 |
| Monoisotopic Mass | 381.07430 |
| SMILES | COc1nc(C)nc(N(C)C(=O)NS(=O)(=O)c2ccccc2C(=O)O)n1 |
| InChI | InChI=1S/C14H15N5O6S/c1-8-15-12(17-13(16-8)25-3)19(2)14(22)18-26(23,24)10-7-5-4-6-9(10)11(20)21/h4-7H,1-3H3,(H,18,22)(H,20,21) |
| InChIKey | BQZXUHDXIARLEO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tribenuron (CHEBI:83571) has role herbicide (CHEBI:24527) |
| tribenuron (CHEBI:83571) is a N-sulfonylurea (CHEBI:76983) |
| tribenuron (CHEBI:83571) is a benzoic acids (CHEBI:22723) |
| tribenuron (CHEBI:83571) is a methoxy-1,3,5-triazine (CHEBI:38177) |
| Incoming Relation(s) |
| tribenuron methyl (CHEBI:9678) has functional parent tribenuron (CHEBI:83571) |
| IUPAC Name |
|---|
| 2-{[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)(methyl)carbamoyl]sulfamoyl}benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 1556 | PPDB |
| C18900 | KEGG COMPOUND |
| tribenuron | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8348441 | Reaxys |
| CAS:106040-48-6 | KEGG COMPOUND |
| CAS:106040-48-6 | ChemIDplus |