EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H19N3O4 |
| Net Charge | 0 |
| Average Mass | 281.312 |
| Monoisotopic Mass | 281.13756 |
| SMILES | CCC(CC)Nc1c([N+](=O)[O-])cc(C)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H19N3O4/c1-5-10(6-2)14-12-11(15(17)18)7-8(3)9(4)13(12)16(19)20/h7,10,14H,5-6H2,1-4H3 |
| InChIKey | CHIFOSRWCNZCFN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pendimethalin (CHEBI:83569) has role agrochemical (CHEBI:33286) |
| pendimethalin (CHEBI:83569) has role environmental contaminant (CHEBI:78298) |
| pendimethalin (CHEBI:83569) has role herbicide (CHEBI:24527) |
| pendimethalin (CHEBI:83569) is a C-nitro compound (CHEBI:35716) |
| pendimethalin (CHEBI:83569) is a secondary amino compound (CHEBI:50995) |
| pendimethalin (CHEBI:83569) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 3,4-dimethyl-2,6-dinitro-N-(pentan-3-yl)aniline |
| Synonyms | Source |
|---|---|
| 3,4-Dimethyl-2,6-dinitro-N-(1-ethylpropyl)aniline | ChemIDplus |
| N-(1-Ethylpropyl)-2,6-dinitro-3,4-xylidine | NIST Chemistry WebBook |
| N-(1-Ethylpropyl)-3,4-dimethyl-2,6-dinitroaniline | ChemIDplus |
| N-(1-Ethylpropyl)-3,4-dimethyl-2,6-dinitrobenzenamine | ChemIDplus |
| N-(3-Pentyl)-3,4-dimethyl-2,6-dinitroaniline | ChemIDplus |
| pendiméthaline | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 511 | PPDB |
| C11019 | KEGG COMPOUND |
| pendimethalin | Alan Wood's Pesticides |
| Pendimethalin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2157711 | Reaxys |
| CAS:40487-42-1 | ChemIDplus |
| CAS:40487-42-1 | KEGG COMPOUND |
| CAS:40487-42-1 | NIST Chemistry WebBook |
| Citations |
|---|