EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17N3S |
| Net Charge | 0 |
| Average Mass | 211.334 |
| Monoisotopic Mass | 211.11432 |
| SMILES | CCCN[C@H]1CCc2nc(N)sc2C1 |
| InChI | InChI=1S/C10H17N3S/c1-2-5-12-7-3-4-8-9(6-7)14-10(11)13-8/h7,12H,2-6H2,1H3,(H2,11,13)/t7-/m0/s1 |
| InChIKey | FASDKYOPVNHBLU-ZETCQYMHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | dopamine agonist A drug that binds to and activates dopamine receptors. |
| Applications: | antidyskinesia agent Any compound which can be used to treat or alleviate the symptoms of dyskinesia. antiparkinson drug A drug used in the treatment of Parkinson's disease. dopamine agonist A drug that binds to and activates dopamine receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pramipexole (CHEBI:8356) has role antidyskinesia agent (CHEBI:66956) |
| pramipexole (CHEBI:8356) has role antiparkinson drug (CHEBI:48407) |
| pramipexole (CHEBI:8356) has role dopamine agonist (CHEBI:51065) |
| pramipexole (CHEBI:8356) has role radical scavenger (CHEBI:48578) |
| pramipexole (CHEBI:8356) is a benzothiazoles (CHEBI:37947) |
| pramipexole (CHEBI:8356) is a diamine (CHEBI:23666) |
| pramipexole (CHEBI:8356) is conjugate base of pramipexole(2+) (CHEBI:63218) |
| Incoming Relation(s) |
| pramipexole(2+) (CHEBI:63218) is conjugate acid of pramipexole (CHEBI:8356) |
| IUPAC Name |
|---|
| (6S)-N6-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine |
| INNs | Source |
|---|---|
| pramipexol | WHO MedNet |
| pramipexole | ChemIDplus |
| pramipexole | WHO MedNet |
| pramipexolum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2,6-Benzothiazolediamine, 4,5,6,7-tetrahydro-N(sup 6)-propyl-, (S)- | ChemIDplus |
| (-)-Pramipexole | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6479326 | Beilstein |
| CAS:104632-26-0 | ChemIDplus |