EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H33N5 |
| Net Charge | 0 |
| Average Mass | 259.442 |
| Monoisotopic Mass | 259.27360 |
| SMILES | NCCCNCCCCN(CCCN)CCCN |
| InChI | InChI=1S/C13H33N5/c14-6-3-10-17-9-1-2-11-18(12-4-7-15)13-5-8-16/h17H,1-16H2 |
| InChIKey | UAGCUQRCYLGHHF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Thermococcus kodakarensis (ncbitaxon:311400) | - | PubMed (24610711) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N4-aminopropylspermine (CHEBI:83554) has functional parent spermine (CHEBI:15746) |
| N4-aminopropylspermine (CHEBI:83554) has role bacterial metabolite (CHEBI:76969) |
| N4-aminopropylspermine (CHEBI:83554) is a polyazaalkane (CHEBI:39474) |
| N4-aminopropylspermine (CHEBI:83554) is a primary amino compound (CHEBI:50994) |
| N4-aminopropylspermine (CHEBI:83554) is a tertiary amino compound (CHEBI:50996) |
| N4-aminopropylspermine (CHEBI:83554) is conjugate base of N4-aminopropylspermine(5+) (CHEBI:82772) |
| Incoming Relation(s) |
| N4-aminopropylspermine(5+) (CHEBI:82772) is conjugate acid of N4-aminopropylspermine (CHEBI:83554) |
| IUPAC Name |
|---|
| N,N,N'-tris(3-aminpropyl)butane-1,4-diamine |
| Synonym | Source |
|---|---|
| N4-(3-aminopropyl)spermine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9937953 | Reaxys |
| Citations |
|---|