EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11ClN4OS |
| Net Charge | 0 |
| Average Mass | 270.745 |
| Monoisotopic Mass | 270.03421 |
| SMILES | NC(=O)N=C1SCCN1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C10H11ClN4OS/c11-8-2-1-7(5-13-8)6-15-3-4-17-10(15)14-9(12)16/h1-2,5H,3-4,6H2,(H2,12,16) |
| InChIKey | LEZHOZPJYAQQNU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiacloprid-amide (CHEBI:83543) has role marine xenobiotic metabolite (CHEBI:83399) |
| thiacloprid-amide (CHEBI:83543) is a monochloropyridine (CHEBI:39172) |
| thiacloprid-amide (CHEBI:83543) is a thiazolidines (CHEBI:35622) |
| thiacloprid-amide (CHEBI:83543) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| 1-{3-[(6-chloropyridin-3-yl)methyl]-1,3-thiazolidin-2-ylidene}urea |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20544098 | Reaxys |
| Citations |
|---|