EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H9F34O4P |
| Net Charge | 0 |
| Average Mass | 990.194 |
| Monoisotopic Mass | 989.96955 |
| SMILES | O=P(O)(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H9F34O4P/c21-5(22,7(25,26)9(29,30)11(33,34)13(37,38)15(41,42)17(45,46)19(49,50)51)1-3-57-59(55,56)58-4-2-6(23,24)8(27,28)10(31,32)12(35,36)14(39,40)16(43,44)18(47,48)20(52,53)54/h1-4H2,(H,55,56) |
| InChIKey | AFWOYEYXUDHGHF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bisperfluorodecyl phosphate (CHEBI:83540) has role environmental contaminant (CHEBI:78298) |
| bisperfluorodecyl phosphate (CHEBI:83540) has role xenobiotic (CHEBI:35703) |
| bisperfluorodecyl phosphate (CHEBI:83540) is a dialkyl phosphate (CHEBI:16648) |
| bisperfluorodecyl phosphate (CHEBI:83540) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl) hydrogen phosphate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11121026 | Reaxys |
| CAS:678-41-1 | ChemIDplus |