EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H9F26O4P |
| Net Charge | 0 |
| Average Mass | 790.166 |
| Monoisotopic Mass | 789.98233 |
| SMILES | O=P(O)(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H9F26O4P/c17-5(18,7(21,22)9(25,26)11(29,30)13(33,34)15(37,38)39)1-3-45-47(43,44)46-4-2-6(19,20)8(23,24)10(27,28)12(31,32)14(35,36)16(40,41)42/h1-4H2,(H,43,44) |
| InChIKey | ZDYYWMSLMLTXDM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bisperfluorooctyl phosphate (CHEBI:83539) has role environmental contaminant (CHEBI:78298) |
| bisperfluorooctyl phosphate (CHEBI:83539) has role xenobiotic (CHEBI:35703) |
| bisperfluorooctyl phosphate (CHEBI:83539) is a dialkyl phosphate (CHEBI:16648) |
| bisperfluorooctyl phosphate (CHEBI:83539) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) hydrogen phosphate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10634221 | Reaxys |
| CAS:57677-95-9 | ChemIDplus |