EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16N2 |
| Net Charge | 0 |
| Average Mass | 176.263 |
| Monoisotopic Mass | 176.13135 |
| SMILES | c1ccc(CN2CCNCC2)cc1 |
| InChI | InChI=1S/C11H16N2/c1-2-4-11(5-3-1)10-13-8-6-12-7-9-13/h1-5,12H,6-10H2 |
| InChIKey | IQXXEPZFOOTTBA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. psychotropic drug A loosely defined grouping of drugs that have effects on psychological function. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-benzylpiperazine (CHEBI:83537) has role environmental contaminant (CHEBI:78298) |
| 1-benzylpiperazine (CHEBI:83537) has role psychotropic drug (CHEBI:35471) |
| 1-benzylpiperazine (CHEBI:83537) has role serotonergic agonist (CHEBI:35941) |
| 1-benzylpiperazine (CHEBI:83537) has role xenobiotic (CHEBI:35703) |
| 1-benzylpiperazine (CHEBI:83537) is a N-alkylpiperazine (CHEBI:46845) |
| IUPAC Name |
|---|
| 1-benzylpiperazine |
| Synonyms | Source |
|---|---|
| Benzylpiperazine | ChemIDplus |
| BZP | NIST Chemistry WebBook |
| N-Benzylpiperazine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Benzylpiperazine | Wikipedia |
| Citations |
|---|