EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H36O15 |
| Net Charge | 0 |
| Average Mass | 612.581 |
| Monoisotopic Mass | 612.20542 |
| SMILES | COc1ccc(CCC(=O)c2c(O)cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[C@@H]3O[C@@H](C)[C@H](O)[C@@H](O)[C@H]3O)cc2O)cc1O |
| InChI | InChI=1S/C28H36O15/c1-11-21(34)23(36)25(38)27(40-11)43-26-24(37)22(35)19(10-29)42-28(26)41-13-8-16(32)20(17(33)9-13)14(30)5-3-12-4-6-18(39-2)15(31)7-12/h4,6-9,11,19,21-29,31-38H,3,5,10H2,1-2H3/t11-,19+,21-,22+,23+,24-,25+,26+,27-,28+/m0/s1 |
| InChIKey | ITVGXXMINPYUHD-CUVHLRMHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | sweetening agent Substance that sweeten food, beverages, medications, etc. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | sweetening agent Substance that sweeten food, beverages, medications, etc. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neohesperidin dihydrochalcone (CHEBI:83535) has role environmental contaminant (CHEBI:78298) |
| neohesperidin dihydrochalcone (CHEBI:83535) has role plant metabolite (CHEBI:76924) |
| neohesperidin dihydrochalcone (CHEBI:83535) has role sweetening agent (CHEBI:50505) |
| neohesperidin dihydrochalcone (CHEBI:83535) has role xenobiotic (CHEBI:35703) |
| neohesperidin dihydrochalcone (CHEBI:83535) is a dihydrochalcones (CHEBI:71230) |
| neohesperidin dihydrochalcone (CHEBI:83535) is a disaccharide derivative (CHEBI:63353) |
| neohesperidin dihydrochalcone (CHEBI:83535) is a neohesperidoside (CHEBI:25495) |
| IUPAC Name |
|---|
| 3,5-dihydroxy-4-[3-(3-hydroxy-4-methoxyphenyl)propanoyl]phenyl 2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside |
| Manual Xrefs | Databases |
|---|---|
| KR20110088743 | Patent |
| WO2011066754 | Patent |
| Neohesperidin_dihydrochalcone | Wikipedia |
| HMDB0030542 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4285336 | Reaxys |
| CAS:20702-77-6 | ChemIDplus |
| Citations |
|---|