EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H17ClN2O2 |
| Net Charge | 0 |
| Average Mass | 268.744 |
| Monoisotopic Mass | 268.09786 |
| SMILES | O=C(NCCN1CCOCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H17ClN2O2/c14-12-3-1-11(2-4-12)13(17)15-5-6-16-7-9-18-10-8-16/h1-4H,5-10H2,(H,15,17) |
| InChIKey | YHXISWVBGDMDLQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| moclobemide (CHEBI:83531) has role antidepressant (CHEBI:35469) |
| moclobemide (CHEBI:83531) has role environmental contaminant (CHEBI:78298) |
| moclobemide (CHEBI:83531) has role xenobiotic (CHEBI:35703) |
| moclobemide (CHEBI:83531) is a benzamides (CHEBI:22702) |
| moclobemide (CHEBI:83531) is a monochlorobenzenes (CHEBI:83403) |
| moclobemide (CHEBI:83531) is a morpholines (CHEBI:38785) |
| IUPAC Name |
|---|
| 4-chloro-N-[2-(morpholin-4-yl)ethyl]benzamide |
| INNs | Source |
|---|---|
| moclobemidum | ChemIDplus |
| moclobemide | ChemIDplus |
| moclobemida | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0015302 | HMDB |
| D02561 | KEGG DRUG |
| DB01171 | DrugBank |
| LSM-5247 | LINCS |
| 1825 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:530974 | Reaxys |
| CAS:71320-77-9 | KEGG DRUG |
| CAS:71320-77-9 | NIST Chemistry WebBook |
| CAS:71320-77-9 | ChemIDplus |
| Citations |
|---|