EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16N2O3 |
| Net Charge | 0 |
| Average Mass | 224.260 |
| Monoisotopic Mass | 224.11609 |
| SMILES | NCC(O)COc1ccc(CC(N)=O)cc1 |
| InChI | InChI=1S/C11H16N2O3/c12-6-9(14)7-16-10-3-1-8(2-4-10)5-11(13)15/h1-4,9,14H,5-7,12H2,(H2,13,15) |
| InChIKey | UWMXVJVTKRSOPW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| atenolol-desisopropyl (CHEBI:83530) has role drug metabolite (CHEBI:49103) |
| atenolol-desisopropyl (CHEBI:83530) has role marine xenobiotic metabolite (CHEBI:83399) |
| atenolol-desisopropyl (CHEBI:83530) is a aromatic ether (CHEBI:35618) |
| atenolol-desisopropyl (CHEBI:83530) is a ethanolamines (CHEBI:23981) |
| atenolol-desisopropyl (CHEBI:83530) is a monocarboxylic acid amide (CHEBI:29347) |
| atenolol-desisopropyl (CHEBI:83530) is a primary amino compound (CHEBI:50994) |
| atenolol-desisopropyl (CHEBI:83530) is a propanolamine (CHEBI:35533) |
| IUPAC Name |
|---|
| 2-[4-(3-amino-2-hydroxypropoxy)phenyl]acetamide |
| Synonym | Source |
|---|---|
| 4-(3-amino-2-hydroxypropoxy)phenylacetamide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5530849 | Reaxys |