EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23NO2 |
| Net Charge | 0 |
| Average Mass | 249.354 |
| Monoisotopic Mass | 249.17288 |
| SMILES | CNCC(c1ccc(O)cc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C15H23NO2/c1-16-11-14(12-5-7-13(17)8-6-12)15(18)9-3-2-4-10-15/h5-8,14,16-18H,2-4,9-11H2,1H3 |
| InChIKey | MMSWXJSQCAEDLK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,O-didesmethylvenlafaxine (CHEBI:83529) has role drug metabolite (CHEBI:49103) |
| N,O-didesmethylvenlafaxine (CHEBI:83529) has role marine xenobiotic metabolite (CHEBI:83399) |
| N,O-didesmethylvenlafaxine (CHEBI:83529) is a cyclohexanols (CHEBI:23480) |
| N,O-didesmethylvenlafaxine (CHEBI:83529) is a phenols (CHEBI:33853) |
| N,O-didesmethylvenlafaxine (CHEBI:83529) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 4-[1-(1-hydroxycyclohexyl)-2-(methylamino)ethyl]phenol |
| Synonym | Source |
|---|---|
| N-desmethyldesvenlafaxine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8846364 | Reaxys |
| CAS:135308-74-6 | ChemIDplus |