EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H26N2O2 |
| Net Charge | 0 |
| Average Mass | 290.407 |
| Monoisotopic Mass | 290.19943 |
| SMILES | CNCCCC(C#N)(c1ccc(OC)c(OC)c1)C(C)C |
| InChI | InChI=1S/C17H26N2O2/c1-13(2)17(12-18,9-6-10-19-3)14-7-8-15(20-4)16(11-14)21-5/h7-8,11,13,19H,6,9-10H2,1-5H3 |
| InChIKey | WLOBUUJURNEQCL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D617 (CHEBI:83528) has role drug metabolite (CHEBI:49103) |
| D617 (CHEBI:83528) has role marine xenobiotic metabolite (CHEBI:83399) |
| D617 (CHEBI:83528) is a dimethoxybenzene (CHEBI:51681) |
| D617 (CHEBI:83528) is a nitrile (CHEBI:18379) |
| D617 (CHEBI:83528) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 2-(3,4-dimethoxyphenyl)-5-(methylamino)-2-(propan-2-yl)pentanenitrile |
| Synonyms | Source |
|---|---|
| 2-(3,4-dimethoxyphenyl)-5-amino-2-isopropylvaleronitrile | ChemIDplus |
| 3-(3,4-dimethoxyphenyl)-2-methyl-6-methylaminohexane-3-carbonitrile | ChemIDplus |
| 3,4-dimethoxy-α-(3-(methylamino)propyl)-α-(1-methylethyl)benzeneacetonitrile | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2751750 | Reaxys |
| CAS:34245-14-2 | ChemIDplus |
| Citations |
|---|