EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H25NO2 |
| Net Charge | 0 |
| Average Mass | 263.381 |
| Monoisotopic Mass | 263.18853 |
| SMILES | CN(C)CC(c1ccc(O)cc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C16H25NO2/c1-17(2)12-15(13-6-8-14(18)9-7-13)16(19)10-4-3-5-11-16/h6-9,15,18-19H,3-5,10-12H2,1-2H3 |
| InChIKey | KYYIDSXMWOZKMP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-desmethylvenlafaxine (CHEBI:83527) has role antidepressant (CHEBI:35469) |
| O-desmethylvenlafaxine (CHEBI:83527) has role drug metabolite (CHEBI:49103) |
| O-desmethylvenlafaxine (CHEBI:83527) has role marine xenobiotic metabolite (CHEBI:83399) |
| O-desmethylvenlafaxine (CHEBI:83527) is a cyclohexanols (CHEBI:23480) |
| O-desmethylvenlafaxine (CHEBI:83527) is a phenols (CHEBI:33853) |
| O-desmethylvenlafaxine (CHEBI:83527) is a tertiary amino compound (CHEBI:50996) |
| INN | Source |
|---|---|
| desvenlafaxine | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol | ChEBI |
| 1-[2-(dimethylamino)-1-(4-hydroxyphenyl)ethyl]cyclohexanol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0015646 | HMDB |
| Desvenlafaxine | Wikipedia |
| DB06700 | DrugBank |
| D07793 | KEGG DRUG |
| 4380 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4234613 | Reaxys |
| CAS:93413-62-8 | ChemIDplus |
| Citations |
|---|