EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H25NO2 |
| Net Charge | 0 |
| Average Mass | 263.381 |
| Monoisotopic Mass | 263.18853 |
| SMILES | CNCC(c1ccc(OC)cc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C16H25NO2/c1-17-12-15(16(18)10-4-3-5-11-16)13-6-8-14(19-2)9-7-13/h6-9,15,17-18H,3-5,10-12H2,1-2H3 |
| InChIKey | MKAFOJAJJMUXLW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-desmethylvenlafaxine (CHEBI:83525) has role drug metabolite (CHEBI:49103) |
| N-desmethylvenlafaxine (CHEBI:83525) has role marine xenobiotic metabolite (CHEBI:83399) |
| N-desmethylvenlafaxine (CHEBI:83525) is a cyclohexanols (CHEBI:23480) |
| N-desmethylvenlafaxine (CHEBI:83525) is a monomethoxybenzene (CHEBI:25235) |
| N-desmethylvenlafaxine (CHEBI:83525) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 1-[1-(4-methoxyphenyl)-2-(methylamino)ethyl]cyclohexanol |
| Synonym | Source |
|---|---|
| Norvenlafaxine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4234609 | Reaxys |
| CAS:149289-30-5 | ChemIDplus |
| Citations |
|---|