EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22ClNO2 |
| Net Charge | 0 |
| Average Mass | 295.810 |
| Monoisotopic Mass | 295.13391 |
| SMILES | CCOCCN(C(=O)CCl)C(=C(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H22ClNO2/c1-4-20-11-10-18(15(19)12-17)16(13(2)3)14-8-6-5-7-9-14/h5-9H,4,10-12H2,1-3H3 |
| InChIKey | CSWIKHNSBZVWNQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pethoxamide (CHEBI:83523) has role agrochemical (CHEBI:33286) |
| pethoxamide (CHEBI:83523) has role environmental contaminant (CHEBI:78298) |
| pethoxamide (CHEBI:83523) has role herbicide (CHEBI:24527) |
| pethoxamide (CHEBI:83523) has role xenobiotic (CHEBI:35703) |
| pethoxamide (CHEBI:83523) is a ether (CHEBI:25698) |
| pethoxamide (CHEBI:83523) is a monocarboxylic acid amide (CHEBI:29347) |
| pethoxamide (CHEBI:83523) is a olefinic compound (CHEBI:78840) |
| pethoxamide (CHEBI:83523) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 2-chloro-N-(2-ethoxyethyl)-N-(2-methyl-1-phenylprop-1-en-1-yl)acetamide |
| Synonym | Source |
|---|---|
| pethoxamid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1011 | PPDB |
| EP1315420 | Patent |
| pethoxamid | Alan Wood's Pesticides |
| WO0217719 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4873772 | Reaxys |
| CAS:106700-29-2 | ChemIDplus |