EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24O2 |
| Net Charge | 0 |
| Average Mass | 272.388 |
| Monoisotopic Mass | 272.17763 |
| SMILES | CC1COC(=O)c2cc3c(cc21)C(C)(C)C(C)C3(C)C |
| InChI | InChI=1S/C18H24O2/c1-10-9-20-16(19)13-8-15-14(7-12(10)13)17(3,4)11(2)18(15,5)6/h7-8,10-11H,9H2,1-6H3 |
| InChIKey | PGMHPYRIXBRRQD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| galaxolidone (CHEBI:83519) has role marine xenobiotic metabolite (CHEBI:83399) |
| galaxolidone (CHEBI:83519) is a isochromenes (CHEBI:38761) |
| galaxolidone (CHEBI:83519) is a organic heterotricyclic compound (CHEBI:26979) |
| galaxolidone (CHEBI:83519) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| 4,6,6,7,8,8-hexamethyl-4,6,7,8-tetrahydrocyclopenta[g]isochromen-1(3H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9920899 | Reaxys |
| Citations |
|---|