EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11I3N2O5 |
| Net Charge | 0 |
| Average Mass | 643.941 |
| Monoisotopic Mass | 643.78022 |
| SMILES | CC(=O)Nc1c(I)c(C(=O)O)c(I)c(C(=O)NCCO)c1I |
| InChI | InChI=1S/C12H11I3N2O5/c1-4(19)17-10-8(14)5(11(20)16-2-3-18)7(13)6(9(10)15)12(21)22/h18H,2-3H2,1H3,(H,16,20)(H,17,19)(H,21,22) |
| InChIKey | OLAOYPRJVHUHCF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | radioopaque medium A substance having the property of absorbing, and therefore being opaque to, electromagnetic radiation, particularly X-rays. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iooxitalamic acid (CHEBI:83517) has role environmental contaminant (CHEBI:78298) |
| iooxitalamic acid (CHEBI:83517) has role radioopaque medium (CHEBI:37338) |
| iooxitalamic acid (CHEBI:83517) has role xenobiotic (CHEBI:35703) |
| iooxitalamic acid (CHEBI:83517) is a acetamides (CHEBI:22160) |
| iooxitalamic acid (CHEBI:83517) is a benzoic acids (CHEBI:22723) |
| iooxitalamic acid (CHEBI:83517) is a dicarboxylic acid monoamide (CHEBI:35735) |
| iooxitalamic acid (CHEBI:83517) is a organoiodine compound (CHEBI:37142) |
| IUPAC Name |
|---|
| 3-(acetylamino)-5-[(2-hydroxyethyl)carbamoyl]-2,4,6-triiodobenzoic acid |
| INNs | Source |
|---|---|
| acide ioxitalamique | ChemIDplus |
| acido ioxitalamico | ChemIDplus |
| acidum ioxitalamicum | ChemIDplus |
| ioxitalamic acid | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5-acetamido-2,4,6-triiodo-N-(2-hydroxyethyl)-isophthalamic acid | ChEBI |
| AG 58107 | ChEMBL |
| AG-58107 | ChEMBL |
| ioxitalamic acid | ChEMBL |
| Ioxithalamic acid | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4582 | DrugCentral |
| D07418 | KEGG DRUG |
| Ioxitalamic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2903918 | Reaxys |
| CAS:28179-44-4 | ChemIDplus |
| CAS:28179-44-4 | KEGG DRUG |
| Citations |
|---|