EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N2O |
| Net Charge | 0 |
| Average Mass | 178.235 |
| Monoisotopic Mass | 178.11061 |
| SMILES | CC(C)c1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C10H14N2O/c1-7(2)8-3-5-9(6-4-8)12-10(11)13/h3-7H,1-2H3,(H3,11,12,13) |
| InChIKey | ABBKOIZWGCVCKE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoproturon-didemethyl (CHEBI:83514) has role marine xenobiotic metabolite (CHEBI:83399) |
| isoproturon-didemethyl (CHEBI:83514) is a phenylureas (CHEBI:134043) |
| IUPAC Name |
|---|
| 1-[4-(propan-2-yl)phenyl]urea |
| Synonym | Source |
|---|---|
| N'-(4-isopropylphenyl)-urea | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2720648 | Reaxys |
| CAS:56046-17-4 | ChemIDplus |