EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO4S |
| Net Charge | 0 |
| Average Mass | 215.230 |
| Monoisotopic Mass | 215.02523 |
| SMILES | COC(=O)c1ccccc1S(N)(=O)=O |
| InChI | InChI=1S/C8H9NO4S/c1-13-8(10)6-4-2-3-5-7(6)14(9,11)12/h2-5H,1H3,(H2,9,11,12) |
| InChIKey | VSOOBQALJVLTBH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-aminosulfonyl-benzoic acid methyl ester (CHEBI:83512) has role marine xenobiotic metabolite (CHEBI:83399) |
| 2-aminosulfonyl-benzoic acid methyl ester (CHEBI:83512) is a benzoate ester (CHEBI:36054) |
| 2-aminosulfonyl-benzoic acid methyl ester (CHEBI:83512) is a methyl ester (CHEBI:25248) |
| 2-aminosulfonyl-benzoic acid methyl ester (CHEBI:83512) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| methyl 2-sulfamoylbenzoate |
| Synonyms | Source |
|---|---|
| 2-(methoxycarbonyl)benzenesulphonamide | ChEBI |
| 2-sulfamoylbenzoic acid methyl ester | ChemIDplus |
| methyl o-sulphamoylbenzoate | ChemIDplus |
| 2-methoxycarbonylphenylsulfonamide | ChEBI |
| 2-(aminosulfonyl)benzoic acid methyl ester | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2728611 | Reaxys |
| CAS:57683-71-3 | ChemIDplus |
| CAS:57683-71-3 | NIST Chemistry WebBook |