EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O5S |
| Net Charge | 0 |
| Average Mass | 256.279 |
| Monoisotopic Mass | 256.04054 |
| SMILES | CC1(C)C(=O)Oc2ccc(OS(C)(=O)=O)cc21 |
| InChI | InChI=1S/C11H12O5S/c1-11(2)8-6-7(16-17(3,13)14)4-5-9(8)15-10(11)12/h4-6H,1-3H3 |
| InChIKey | CXWYCAYNZXSHTF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethofumesate-2-keto (CHEBI:83510) has role marine xenobiotic metabolite (CHEBI:83399) |
| ethofumesate-2-keto (CHEBI:83510) is a 1-benzofurans (CHEBI:38830) |
| ethofumesate-2-keto (CHEBI:83510) is a methanesulfonate ester (CHEBI:25223) |
| ethofumesate-2-keto (CHEBI:83510) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| 3,3-dimethyl-2-oxo-2,3-dihydro-1-benzofuran-5-yl methanesulfonate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1585374 | Reaxys |