EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H42N2O18 |
| Net Charge | 0 |
| Average Mass | 826.761 |
| Monoisotopic Mass | 826.24326 |
| SMILES | COc1cc(O)c2c(c1)C(=O)c1c(cc3c(c1O)-c1c(cc(C)c(C(=O)N[C@H](C)C(=O)O)c1O)[C@H](O[C@@H]1O[C@H](C)[C@H](N)[C@H](O[C@@H]4OC[C@@H](O)[C@H](O)[C@H]4O)[C@H]1O)[C@H]3O)C2=O |
| InChI | InChI=1S/C39H42N2O18/c1-10-5-17-23(30(48)20(10)36(52)41-11(2)37(53)54)22-15(8-16-24(31(22)49)27(45)14-6-13(55-4)7-18(42)21(14)26(16)44)28(46)34(17)58-39-33(51)35(25(40)12(3)57-39)59-38-32(50)29(47)19(43)9-56-38/h5-8,11-12,19,25,28-29,32-35,38-39,42-43,46-51H,9,40H2,1-4H3,(H,41,52)(H,53,54)/t11-,12-,19-,25+,28+,29+,32-,33-,34+,35+,38+,39+/m1/s1 |
| InChIKey | IHIIRQILYAXIOH-NUVDETJMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinomadura hibisca (ncbitaxon:68565) | - | PubMed (21119678) | Strain: P157-2 (ATCC 53557). |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pradimicin C (CHEBI:8351) has functional parent D-alanine (CHEBI:15570) |
| pradimicin C (CHEBI:8351) is a L-alanine derivative (CHEBI:83943) |
| pradimicin C (CHEBI:8351) is a aromatic ether (CHEBI:35618) |
| pradimicin C (CHEBI:8351) is a disaccharide derivative (CHEBI:63353) |
| pradimicin C (CHEBI:8351) is a polyketide (CHEBI:26188) |
| pradimicin C (CHEBI:8351) is a polyphenol (CHEBI:26195) |
| pradimicin C (CHEBI:8351) is a pradimicin (CHEBI:83230) |
| pradimicin C (CHEBI:8351) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (2R)-2-({[(5S,6S)-5-{[(2S,3R,4S,5S,6R)-5-amino-3-hydroxy-6-methyl-4-{[(2S,3R,4S,5R)-3,4,5-trihydroxytetrahydro-2H-pyran-2-yl]oxy}tetrahydro-2H-pyran-2-yl]oxy}-1,6,9,14-tetrahydroxy-11-methoxy-3-methyl-8,13-dioxo-5,6,8,13-tetrahydrobenzo[a]tetracen-2-yl]carbonyl}amino)propanoic acid |
| Synonym | Source |
|---|---|
| Benanomicin B | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4645265 | Reaxys |
| CAS:116249-66-2 | KEGG COMPOUND |
| CAS:116249-66-2 | ChemIDplus |
| Citations |
|---|