EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19NO2 |
| Net Charge | 0 |
| Average Mass | 233.311 |
| Monoisotopic Mass | 233.14158 |
| SMILES | CCc1cccc(C)c1N1C(=O)COCC1C |
| InChI | InChI=1S/C14H19NO2/c1-4-12-7-5-6-10(2)14(12)15-11(3)8-17-9-13(15)16/h5-7,11H,4,8-9H2,1-3H3 |
| InChIKey | DVBDYPDVNRJKNJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metolachlor morpholinone (CHEBI:83509) has role marine xenobiotic metabolite (CHEBI:83399) |
| metolachlor morpholinone (CHEBI:83509) is a morpholines (CHEBI:38785) |
| metolachlor morpholinone (CHEBI:83509) is a δ-lactam (CHEBI:77727) |
| IUPAC Name |
|---|
| 4-(2-ethyl-6-methylphenyl)-5-methylmorpholin-3-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7709408 | Reaxys |
| CAS:120375-14-6 | ChemIDplus |
| Citations |
|---|