EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H6F13O4P |
| Net Charge | 0 |
| Average Mass | 444.080 |
| Monoisotopic Mass | 443.97961 |
| SMILES | O=P(O)(O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H6F13O4P/c9-3(10,1-2-25-26(22,23)24)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21/h1-2H2,(H2,22,23,24) |
| InChIKey | FZTRDYSPWWJCOF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perfluorooctyl phosphate (CHEBI:83508) has role environmental contaminant (CHEBI:78298) |
| perfluorooctyl phosphate (CHEBI:83508) has role xenobiotic (CHEBI:35703) |
| perfluorooctyl phosphate (CHEBI:83508) is a monoalkyl phosphate (CHEBI:25381) |
| perfluorooctyl phosphate (CHEBI:83508) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl dihydrogen phosphate |