EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:83506 - N-methylperfluorooctane sulfonamidoacetic acid
| Formula | C11H6F17NO4S |
| Net Charge | 0 |
| Average Mass | 571.205 |
| Monoisotopic Mass | 570.97461 |
| SMILES | CN(CC(=O)O)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H6F17NO4S/c1-29(2-3(30)31)34(32,33)11(27,28)9(22,23)7(18,19)5(14,15)4(12,13)6(16,17)8(20,21)10(24,25)26/h2H2,1H3,(H,30,31) |
| InChIKey | QNDHIRFIMVNHBN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methylperfluorooctane sulfonamidoacetic acid (CHEBI:83506) has role environmental contaminant (CHEBI:78298) |
| N-methylperfluorooctane sulfonamidoacetic acid (CHEBI:83506) has role xenobiotic (CHEBI:35703) |
| N-methylperfluorooctane sulfonamidoacetic acid (CHEBI:83506) is a monocarboxylic acid (CHEBI:25384) |
| N-methylperfluorooctane sulfonamidoacetic acid (CHEBI:83506) is a organofluorine compound (CHEBI:37143) |
| N-methylperfluorooctane sulfonamidoacetic acid (CHEBI:83506) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| N-[(heptadecafluorooctyl)sulfonyl]-N-methylglycine |
| Synonym | Source |
|---|---|
| 2-(N-methyl-perfluorooctane sulfonamido) acetic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9740270 | Reaxys |