EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14ClNO2S |
| Net Charge | 0 |
| Average Mass | 307.802 |
| Monoisotopic Mass | 307.04338 |
| SMILES | O=C(O)C(c1ccccc1Cl)N1CCc2sccc2C1 |
| InChI | InChI=1S/C15H14ClNO2S/c16-12-4-2-1-3-11(12)14(15(18)19)17-7-5-13-10(9-17)6-8-20-13/h1-4,6,8,14H,5,7,9H2,(H,18,19) |
| InChIKey | DCASRSISIKYPDD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clopidogrel carboxylic acid (CHEBI:83504) has role drug metabolite (CHEBI:49103) |
| clopidogrel carboxylic acid (CHEBI:83504) has role marine xenobiotic metabolite (CHEBI:83399) |
| clopidogrel carboxylic acid (CHEBI:83504) is a monocarboxylic acid (CHEBI:25384) |
| clopidogrel carboxylic acid (CHEBI:83504) is a monochlorobenzenes (CHEBI:83403) |
| clopidogrel carboxylic acid (CHEBI:83504) is a tertiary amino compound (CHEBI:50996) |
| clopidogrel carboxylic acid (CHEBI:83504) is a thienopyridine (CHEBI:37942) |
| IUPAC Name |
|---|
| (2-chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14366675 | Reaxys |
| Citations |
|---|