EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30N2O5 |
| Net Charge | 0 |
| Average Mass | 378.469 |
| Monoisotopic Mass | 378.21547 |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(=O)O)NCCC(C)(C)C |
| InChI | InChI=1S/C20H30N2O5/c1-20(2,3)10-11-21-15(13-17(23)24)18(25)22-16(19(26)27-4)12-14-8-6-5-7-9-14/h5-9,15-16,21H,10-13H2,1-4H3,(H,22,25)(H,23,24)/t15-,16-/m0/s1 |
| InChIKey | HLIAVLHNDJUHFG-HOTGVXAUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | sweetening agent Substance that sweeten food, beverages, medications, etc. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | sweetening agent Substance that sweeten food, beverages, medications, etc. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neotame (CHEBI:83503) has role environmental contaminant (CHEBI:78298) |
| neotame (CHEBI:83503) has role sweetening agent (CHEBI:50505) |
| neotame (CHEBI:83503) has role xenobiotic (CHEBI:35703) |
| neotame (CHEBI:83503) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| methyl N-(3,3-dimethylbutyl)-L-α-aspartyl-L-phenylalaninate |
| Synonym | Source |
|---|---|
| N-[N-(3,3-dimethylbutyl)-L-α-aspartyl]-L-phenylalanine methyl ester | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Neotame | Wikipedia |
| HMDB0034566 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8352678 | Reaxys |
| CAS:165450-17-9 | ChemIDplus |
| Citations |
|---|