EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20N6O7S |
| Net Charge | 0 |
| Average Mass | 452.449 |
| Monoisotopic Mass | 452.11142 |
| SMILES | COc1cc(OC)nc(NC(=O)NS(=O)(=O)c2cc(NC=O)ccc2C(=O)N(C)C)n1 |
| InChI | InChI=1S/C17H20N6O7S/c1-23(2)15(25)11-6-5-10(18-9-24)7-12(11)31(27,28)22-17(26)21-16-19-13(29-3)8-14(20-16)30-4/h5-9H,1-4H3,(H,18,24)(H2,19,20,21,22,26) |
| InChIKey | PXDNXJSDGQBLKS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| foramsulfuron (CHEBI:83502) has role environmental contaminant (CHEBI:78298) |
| foramsulfuron (CHEBI:83502) has role herbicide (CHEBI:24527) |
| foramsulfuron (CHEBI:83502) has role xenobiotic (CHEBI:35703) |
| foramsulfuron (CHEBI:83502) is a aromatic ether (CHEBI:35618) |
| foramsulfuron (CHEBI:83502) is a benzamides (CHEBI:22702) |
| foramsulfuron (CHEBI:83502) is a pyrimidines (CHEBI:39447) |
| foramsulfuron (CHEBI:83502) is a sulfonamide (CHEBI:35358) |
| foramsulfuron (CHEBI:83502) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| 2-{[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamoyl}-4-(formylamino)-N,N-dimethylbenzamide |
| Synonym | Source |
|---|---|
| 1-(4,6-dimethoxypyrimidin-2-yl)-3-[2-(dimethylcarbamoyl)-5-formamidophenylsulfonyl]urea | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| foramsulfuron | Alan Wood's Pesticides |
| NZ570537 | Patent |
| 357 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11343669 | Reaxys |
| CAS:173159-57-4 | ChemIDplus |
| Citations |
|---|