EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H9F6N5O4S |
| Net Charge | 0 |
| Average Mass | 445.301 |
| Monoisotopic Mass | 445.02794 |
| SMILES | COc1nc(NC(=O)NS(=O)(=O)c2ccccc2C(F)(F)F)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H9F6N5O4S/c1-28-11-21-8(13(17,18)19)20-9(23-11)22-10(25)24-29(26,27)7-5-3-2-4-6(7)12(14,15)16/h2-5H,1H3,(H2,20,21,22,23,24,25) |
| InChIKey | KVEQCVKVIFQSGC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tritosulfuron (CHEBI:83500) has role environmental contaminant (CHEBI:78298) |
| tritosulfuron (CHEBI:83500) has role herbicide (CHEBI:24527) |
| tritosulfuron (CHEBI:83500) has role xenobiotic (CHEBI:35703) |
| tritosulfuron (CHEBI:83500) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| tritosulfuron (CHEBI:83500) is a N-sulfonylurea (CHEBI:76983) |
| tritosulfuron (CHEBI:83500) is a methoxy-1,3,5-triazine (CHEBI:38177) |
| IUPAC Name |
|---|
| N-{[4-methoxy-6-(trifluoromethyl)-1,3,5-triazin-2-yl]carbamoyl}-2-(trifluoromethyl)benzenesulfonamide |
| Synonym | Source |
|---|---|
| 1-[4-methoxy-6-(trifluoromethyl)-1,3,5-triazin-2-yl]-3-[2-(trifluoromethyl)benzenesulfonyl]urea | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| tritosulfuron | Alan Wood's Pesticides |
| NZ570537 | Patent |
| EA013226 | Patent |
| NZ541924 | Patent |
| 674 | PPDB |
| DE10245222 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11343519 | Reaxys |
| CAS:142469-14-5 | ChemIDplus |
| Citations |
|---|