EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H22N4O4S |
| Net Charge | 0 |
| Average Mass | 330.410 |
| Monoisotopic Mass | 330.13618 |
| SMILES | [H]C(=C(NC)NCCS(=O)Cc1ccc(CN(C)C)o1)[N+](=O)[O-] |
| InChI | InChI=1S/C13H22N4O4S/c1-14-13(9-17(18)19)15-6-7-22(20)10-12-5-4-11(21-12)8-16(2)3/h4-5,9,14-15H,6-8,10H2,1-3H3 |
| InChIKey | SKHXRNHSZTXSLP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ranitidine-S-oxide (CHEBI:83497) has role drug metabolite (CHEBI:49103) |
| ranitidine-S-oxide (CHEBI:83497) has role marine xenobiotic metabolite (CHEBI:83399) |
| ranitidine-S-oxide (CHEBI:83497) is a C-nitro compound (CHEBI:35716) |
| ranitidine-S-oxide (CHEBI:83497) is a furans (CHEBI:24129) |
| ranitidine-S-oxide (CHEBI:83497) is a sulfoxide (CHEBI:22063) |
| ranitidine-S-oxide (CHEBI:83497) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-{2-[({5-[(dimethylamino)methyl]furan-2-yl}methyl)sulfinyl]ethyl}-N'-methyl-2-nitroethene-1,1-diamine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8395257 | Reaxys |
| Citations |
|---|