EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:83493 - perfluoroundecanoic acid
| Formula | C11HF21O2 |
| Net Charge | 0 |
| Average Mass | 564.085 |
| Monoisotopic Mass | 563.96412 |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11HF21O2/c12-2(13,1(33)34)3(14,15)4(16,17)5(18,19)6(20,21)7(22,23)8(24,25)9(26,27)10(28,29)11(30,31)32/h(H,33,34) |
| InChIKey | SIDINRCMMRKXGQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perfluoroundecanoic acid (CHEBI:83493) has functional parent undecanoic acid (CHEBI:32368) |
| perfluoroundecanoic acid (CHEBI:83493) has role environmental contaminant (CHEBI:78298) |
| perfluoroundecanoic acid (CHEBI:83493) has role xenobiotic (CHEBI:35703) |
| perfluoroundecanoic acid (CHEBI:83493) is a fluoroalkanoic acid (CHEBI:35551) |
| IUPAC Name |
|---|
| henicosafluoroundecanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2318888 | Reaxys |
| CAS:2058-94-8 | ChemIDplus |
| Citations |
|---|