EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6HF11O2 |
| Net Charge | 0 |
| Average Mass | 314.050 |
| Monoisotopic Mass | 313.98009 |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6HF11O2/c7-2(8,1(18)19)3(9,10)4(11,12)5(13,14)6(15,16)17/h(H,18,19) |
| InChIKey | PXUULQAPEKKVAH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perfluorohexanoic acid (CHEBI:83492) has functional parent hexanoic acid (CHEBI:30776) |
| perfluorohexanoic acid (CHEBI:83492) has role environmental contaminant (CHEBI:78298) |
| perfluorohexanoic acid (CHEBI:83492) has role xenobiotic (CHEBI:35703) |
| perfluorohexanoic acid (CHEBI:83492) is a fluoroalkanoic acid (CHEBI:35551) |
| IUPAC Name |
|---|
| undecafluorohexanoic acid |
| Synonym | Source |
|---|---|
| 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1805852 | Reaxys |
| CAS:307-24-4 | ChemIDplus |
| Citations |
|---|