EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:83491 - perfluoropentanoic acid
| Formula | C5HF9O2 |
| Net Charge | 0 |
| Average Mass | 264.043 |
| Monoisotopic Mass | 263.98328 |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5HF9O2/c6-2(7,1(15)16)3(8,9)4(10,11)5(12,13)14/h(H,15,16) |
| InChIKey | CXZGQIAOTKWCDB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perfluoropentanoic acid (CHEBI:83491) has functional parent valeric acid (CHEBI:17418) |
| perfluoropentanoic acid (CHEBI:83491) has role environmental contaminant (CHEBI:78298) |
| perfluoropentanoic acid (CHEBI:83491) has role xenobiotic (CHEBI:35703) |
| perfluoropentanoic acid (CHEBI:83491) is a fluoroalkanoic acid (CHEBI:35551) |
| IUPAC Name |
|---|
| nonafluoropentanoic acid |
| Synonyms | Source |
|---|---|
| perfluorovaleric acid | ChemIDplus |
| nonafluoro-1-pentanoic acid | ChemIDplus |
| 2,2,3,3,4,4,5,5,5-nonafluoropentanoic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1800087 | Reaxys |
| CAS:2706-90-3 | ChemIDplus |
| Citations |
|---|