EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H19NO5S |
| Net Charge | 0 |
| Average Mass | 301.364 |
| Monoisotopic Mass | 301.09839 |
| SMILES | COCCN(C(=O)CS(=O)(=O)O)c1c(C)cccc1C |
| InChI | InChI=1S/C13H19NO5S/c1-10-5-4-6-11(2)13(10)14(7-8-19-3)12(15)9-20(16,17)18/h4-6H,7-9H2,1-3H3,(H,16,17,18) |
| InChIKey | RVSCDWJKJDBFRS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimethachlor ESA (CHEBI:83484) has role marine xenobiotic metabolite (CHEBI:83399) |
| dimethachlor ESA (CHEBI:83484) is a aromatic amide (CHEBI:62733) |
| dimethachlor ESA (CHEBI:83484) is a ether (CHEBI:25698) |
| dimethachlor ESA (CHEBI:83484) is a organosulfonic acid (CHEBI:33551) |
| IUPAC Name |
|---|
| 2-[(2,6-dimethylphenyl)(2-methoxyethyl)amino]-2-oxoethanesulfonic acid |
| Citations |
|---|