EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15N3O3 |
| Net Charge | 0 |
| Average Mass | 273.292 |
| Monoisotopic Mass | 273.11134 |
| SMILES | Cc1cccc(C)c1N(Cn1cccn1)C(=O)C(=O)O |
| InChI | InChI=1S/C14H15N3O3/c1-10-5-3-6-11(2)12(10)17(13(18)14(19)20)9-16-8-4-7-15-16/h3-8H,9H2,1-2H3,(H,19,20) |
| InChIKey | PHMHHVKFXZNTKU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metazachlor OXA (CHEBI:83483) has role marine xenobiotic metabolite (CHEBI:83399) |
| metazachlor OXA (CHEBI:83483) is a aromatic amide (CHEBI:62733) |
| metazachlor OXA (CHEBI:83483) is a monocarboxylic acid (CHEBI:25384) |
| metazachlor OXA (CHEBI:83483) is a pyrazoles (CHEBI:26410) |
| IUPAC Name |
|---|
| [(2,6-dimethylphenyl)(1H-pyrazol-1-ylmethyl)amino](oxo)acetic acid |