EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17N3O4S |
| Net Charge | 0 |
| Average Mass | 323.374 |
| Monoisotopic Mass | 323.09398 |
| SMILES | Cc1cccc(C)c1N(Cn1cccn1)C(=O)CS(=O)(=O)O |
| InChI | InChI=1S/C14H17N3O4S/c1-11-5-3-6-12(2)14(11)17(10-16-8-4-7-15-16)13(18)9-22(19,20)21/h3-8H,9-10H2,1-2H3,(H,19,20,21) |
| InChIKey | IPVCSECPEVHQOV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metazachlor ESA (CHEBI:83482) has role marine xenobiotic metabolite (CHEBI:83399) |
| metazachlor ESA (CHEBI:83482) is a aromatic amide (CHEBI:62733) |
| metazachlor ESA (CHEBI:83482) is a organosulfonic acid (CHEBI:33551) |
| metazachlor ESA (CHEBI:83482) is a pyrazoles (CHEBI:26410) |
| IUPAC Name |
|---|
| 2-[(2,6-dimethylphenyl)(1H-pyrazol-1-ylmethyl)amino]-2-oxoethanesulfonic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8394989 | Reaxys |