EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6ClN3O |
| Net Charge | 0 |
| Average Mass | 159.576 |
| Monoisotopic Mass | 159.01994 |
| SMILES | Cn1ncc(N)c(Cl)c1=O |
| InChI | InChI=1S/C5H6ClN3O/c1-9-5(10)4(6)3(7)2-8-9/h2H,7H2,1H3 |
| InChIKey | XNSGCNYTNLWRKM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chloridazone-methyl-desphenyl (CHEBI:83480) has role marine xenobiotic metabolite (CHEBI:83399) |
| chloridazone-methyl-desphenyl (CHEBI:83480) is a organochlorine compound (CHEBI:36683) |
| chloridazone-methyl-desphenyl (CHEBI:83480) is a primary arylamine (CHEBI:50471) |
| chloridazone-methyl-desphenyl (CHEBI:83480) is a pyridazinone (CHEBI:26414) |
| IUPAC Name |
|---|
| 5-amino-4-chloro-2-methylpyridazin-3(2H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:510721 | Reaxys |