EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H4ClN3O |
| Net Charge | 0 |
| Average Mass | 145.549 |
| Monoisotopic Mass | 145.00429 |
| SMILES | Nc1cnnc(O)c1Cl |
| InChI | InChI=1S/C4H4ClN3O/c5-3-2(6)1-7-8-4(3)9/h1H,(H3,6,8,9) |
| InChIKey | FEWPCPCEGBPTAL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chloridazone-desphenyl (CHEBI:83479) has role marine xenobiotic metabolite (CHEBI:83399) |
| chloridazone-desphenyl (CHEBI:83479) is a heteroaryl hydroxy compound (CHEBI:74818) |
| chloridazone-desphenyl (CHEBI:83479) is a organochlorine compound (CHEBI:36683) |
| chloridazone-desphenyl (CHEBI:83479) is a primary arylamine (CHEBI:50471) |
| chloridazone-desphenyl (CHEBI:83479) is a pyridazines (CHEBI:37921) |
| IUPAC Name |
|---|
| 5-amino-4-chloropyridazin-3-ol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:638650 | Reaxys |
| CAS:6339-19-1 | ChemIDplus |
| Citations |
|---|