EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13N5O |
| Net Charge | 0 |
| Average Mass | 183.215 |
| Monoisotopic Mass | 183.11201 |
| SMILES | CCNc1nc(O)nc(NCC)n1 |
| InChI | InChI=1S/C7H13N5O/c1-3-8-5-10-6(9-4-2)12-7(13)11-5/h3-4H2,1-2H3,(H3,8,9,10,11,12,13) |
| InChIKey | YQIXRXMOJFQVBV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| simazine-2-hydroxy (CHEBI:83476) has role marine xenobiotic metabolite (CHEBI:83399) |
| simazine-2-hydroxy (CHEBI:83476) is a diamino-1,3,5-triazine (CHEBI:38170) |
| simazine-2-hydroxy (CHEBI:83476) is a heteroaryl hydroxy compound (CHEBI:74818) |
| IUPAC Name |
|---|
| 4,6-bis(ethylamino)-1,3,5-triazin-2-ol |
| Synonyms | Source |
|---|---|
| 2-hydroxysimazine | ChEBI |
| 4,6-Bis(ethylamino)-s-triazin-2-ol | ChemIDplus |
| hydroxysimazine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:611555 | Reaxys |
| CAS:2599-11-3 | ChemIDplus |
| Citations |
|---|