EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H17N5O |
| Net Charge | 0 |
| Average Mass | 211.269 |
| Monoisotopic Mass | 211.14331 |
| SMILES | CCNc1nc(O)nc(NC(C)(C)C)n1 |
| InChI | InChI=1S/C9H17N5O/c1-5-10-6-11-7(13-8(15)12-6)14-9(2,3)4/h5H2,1-4H3,(H3,10,11,12,13,14,15) |
| InChIKey | OYTCZOJKXCTBHG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| terbutylazine-2-hydroxy (CHEBI:83471) has role marine xenobiotic metabolite (CHEBI:83399) |
| terbutylazine-2-hydroxy (CHEBI:83471) is a diamino-1,3,5-triazine (CHEBI:38170) |
| terbutylazine-2-hydroxy (CHEBI:83471) is a heteroaryl hydroxy compound (CHEBI:74818) |
| IUPAC Name |
|---|
| 4-(tert-butylamino)-6-(ethylamino)-1,3,5-triazin-2-ol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7809080 | Reaxys |
| Citations |
|---|