EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15ClO4 |
| Net Charge | 0 |
| Average Mass | 318.756 |
| Monoisotopic Mass | 318.06589 |
| SMILES | CC(C)(Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C17H15ClO4/c1-17(2,16(20)21)22-14-9-5-12(6-10-14)15(19)11-3-7-13(18)8-4-11/h3-10H,1-2H3,(H,20,21) |
| InChIKey | MQOBSOSZFYZQOK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenofibric acid (CHEBI:83469) has role drug metabolite (CHEBI:49103) |
| fenofibric acid (CHEBI:83469) has role marine xenobiotic metabolite (CHEBI:83399) |
| fenofibric acid (CHEBI:83469) is a aromatic ketone (CHEBI:76224) |
| fenofibric acid (CHEBI:83469) is a chlorobenzophenone (CHEBI:23135) |
| fenofibric acid (CHEBI:83469) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoic acid |
| Synonym | Source |
|---|---|
| Procetofenic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4505 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2058973 | Reaxys |
| CAS:42017-89-0 | ChemIDplus |
| Citations |
|---|