EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8Cl2N2O |
| Net Charge | 0 |
| Average Mass | 219.071 |
| Monoisotopic Mass | 218.00137 |
| SMILES | CNC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H8Cl2N2O/c1-11-8(13)12-5-2-3-6(9)7(10)4-5/h2-4H,1H3,(H2,11,12,13) |
| InChIKey | IDQHRQQSSQDLTR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diuron-desmethyl (CHEBI:83466) has role marine xenobiotic metabolite (CHEBI:83399) |
| diuron-desmethyl (CHEBI:83466) is a a 1-methyl-3-phenylurea (CHEBI:157694) |
| diuron-desmethyl (CHEBI:83466) is a dichlorobenzene (CHEBI:23697) |
| diuron-desmethyl (CHEBI:83466) is a phenylureas (CHEBI:134043) |
| IUPAC Name |
|---|
| 1-(3,4-dichlorophenyl)-3-methylurea |
| Synonyms | Source |
|---|---|
| N-methyl-N'-(3',4'-dichlorophenyl)-urea | ChEBI |
| Monomethyldiuron | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 3-(3,4-dichlorophenyl)-1-methylurea | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2805599 | Reaxys |
| CAS:3567-62-2 | ChemIDplus |
| Citations |
|---|