EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H13ClO5S |
| Net Charge | 0 |
| Average Mass | 328.773 |
| Monoisotopic Mass | 328.01722 |
| SMILES | CS(=O)(=O)c1ccc(C(=O)C2C(=O)CCCC2=O)c(Cl)c1 |
| InChI | InChI=1S/C14H13ClO5S/c1-21(19,20)8-5-6-9(10(15)7-8)14(18)13-11(16)3-2-4-12(13)17/h5-7,13H,2-4H2,1H3 |
| InChIKey | PQTBTIFWAXVEPB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. carotenoid biosynthesis inhibitor Any pathway inhibitor that acts on the carotenoid biosynthesis pathway. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulcotrione (CHEBI:83465) has role carotenoid biosynthesis inhibitor (CHEBI:138208) |
| sulcotrione (CHEBI:83465) has role environmental contaminant (CHEBI:78298) |
| sulcotrione (CHEBI:83465) has role herbicide (CHEBI:24527) |
| sulcotrione (CHEBI:83465) has role xenobiotic (CHEBI:35703) |
| sulcotrione (CHEBI:83465) is a aromatic ketone (CHEBI:76224) |
| sulcotrione (CHEBI:83465) is a cyclohexanones (CHEBI:23482) |
| sulcotrione (CHEBI:83465) is a sulfone (CHEBI:35850) |
| sulcotrione (CHEBI:83465) is a β-triketone (CHEBI:140323) |
| IUPAC Name |
|---|
| 2-[2-chloro-4-(methylsulfonyl)benzoyl]cyclohexane-1,3-dione |
| Manual Xrefs | Databases |
|---|---|
| 600 | PPDB |
| sulcotrione | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8155739 | Reaxys |
| CAS:99105-77-8 | ChemIDplus |
| Citations |
|---|