EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6Cl2N2O |
| Net Charge | 0 |
| Average Mass | 205.044 |
| Monoisotopic Mass | 203.98572 |
| SMILES | NC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C7H6Cl2N2O/c8-5-2-1-4(3-6(5)9)11-7(10)12/h1-3H,(H3,10,11,12) |
| InChIKey | CYESCLHCWJKRKM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diuron-desdimethyl (CHEBI:83464) has role marine xenobiotic metabolite (CHEBI:83399) |
| diuron-desdimethyl (CHEBI:83464) is a dichlorobenzene (CHEBI:23697) |
| diuron-desdimethyl (CHEBI:83464) is a phenylureas (CHEBI:134043) |
| IUPAC Name |
|---|
| 1-(3,4-dichlorophenyl)urea |
| Synonym | Source |
|---|---|
| N-(3,4-dichlorophenyl)urea | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2723039 | Reaxys |
| CAS:2327-02-8 | ChemIDplus |