EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H19NO5S2 |
| Net Charge | 0 |
| Average Mass | 321.420 |
| Monoisotopic Mass | 321.07046 |
| SMILES | COCC(C)N(C(=O)CS(=O)(=O)O)c1c(C)csc1C |
| InChI | InChI=1S/C12H19NO5S2/c1-8-6-19-10(3)12(8)13(9(2)5-18-4)11(14)7-20(15,16)17/h6,9H,5,7H2,1-4H3,(H,15,16,17) |
| InChIKey | YMYKMSAZEZQEER-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimethenamide ESA (CHEBI:83461) has role marine xenobiotic metabolite (CHEBI:83399) |
| dimethenamide ESA (CHEBI:83461) is a aromatic amide (CHEBI:62733) |
| dimethenamide ESA (CHEBI:83461) is a ether (CHEBI:25698) |
| dimethenamide ESA (CHEBI:83461) is a organosulfonic acid (CHEBI:33551) |
| dimethenamide ESA (CHEBI:83461) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| 2-[(2,4-dimethylthiophen-3-yl)(1-methoxypropan-2-yl)amino]-2-oxoethanesulfonic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8150251 | Reaxys |